Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | (Z)-Fluvoxamine |
|---|---|
| Synonyms | 2-[(Z)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine |
| Molecular Structure | ![CAS # 89035-92-7, (Z)-Fluvoxamine, 2-[(Z)-[5-methoxy-1-[4-(trifluoromethyl)phenyl]pentylidene]amino]oxyethanamine](/structures/89035-92-7.gif) |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.33 |
| CAS Registry Number | 89035-92-7 |
| SMILES | COCCCC/C(=N/OCCN)/C1=CC=C(C=C1)C(F)(F)F |
| Solubility | 22.22 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.474, Calc.* |
| Melting point | 107.62 ºC |
| Boiling Point | 351.24 ºC, 370.6±52.0 ºC (760 mmHg), Calc.* |
| Flash Point | 177.9±30.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for (Z)-Fluvoxamine |