| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 6-(Methylsulfonyl)quinoline |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 |
| CAS Registry Number | 89770-29-6 |
| EC Number | 659-522-8 |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)N=CC=C2 |
| Solubility | 1.014e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.618, Calc.* |
| Melting point | 126.55 ºC |
| Boiling Point | 356.64 ºC, 428.2±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 212.7±23.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H319 Details | ||||||||||||||||||||||||||||
| Precautionary Statements | P264+P265-P280-P305+P351+P338-P337+P317 Details | ||||||||||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 6-(Methylsulfonyl)quinoline |