| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5-(4-chlorophenyl)-N-(2-morpholin-4-ylethyl)isoxazole-3-carboxamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 |
| CAS Registry Number | 909090-75-1 |
| SMILES | C1COCCN1CCNC(=O)C2=NOC(=C2)C3=CC=C(C=C3)Cl |
| Solubility | 224.5 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.565, Calc.* |
| Melting point | 214.00 ºC |
| Boiling Point | 559.5±50.0 ºC (760 mmHg), Calc.*, 503.00 ºC |
| Flash Point | 292.2±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319 Details |
| Precautionary Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 5-(4-chlorophenyl)-N-(2-morpholin-4-ylethyl)isoxazole-3-carboxamide |