| Mayue Longteng Technology Development Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15171477138 | |||
![]() |
helen.yan@lantu-tech.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 15171477138 | |||
| chemBlink standard supplier since 2023 | ||||
| Name | 3-Bromo-2-phenylpyridine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H8BrN |
| Molecular Weight | 234.09 |
| CAS Registry Number | 91182-50-2 |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)Br |
| Solubility | 32.18 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.606, Calc.* |
| Melting point | 94.11 ºC |
| Boiling Point | 318.87 ºC, 296.1±20.0 ºC (760 mmHg), Calc.* |
| Flash Point | 132.9±21.8 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-2-phenylpyridine |