| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Name | [(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 |
| CAS Registry Number | 91926-31-7 |
| SMILES | C[C@H]1[C@H]([C@H](C=CO1)OC(=O)C)OC(=O)C |
| Solubility | 1.216e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.474, Calc.* |
| Melting point | -29.01 ºC |
| Boiling Point | 249.09 ºC, 295.9±0.0 ºC (760 mmHg), Calc.* |
| Flash Point | 116.4±27.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302- Details |
| Precautionary Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for [(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |