| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | 1,1',1''-(1,3,5-Triazinane-1,3,5-triyl)tris(2-bromoethan-1-one) |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H12Br3N3O3 |
| Molecular Weight | 449.92 |
| CAS Registry Number | 92531-02-7 |
| SMILES | C1N(CN(CN1C(=O)CBr)C(=O)CBr)C(=O)CBr |
| Solubility | 2126 mg/L (25 ºC water) |
|---|---|
| Density | 2.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.626, Calc.* |
| Melting point | 208.93 ºC |
| Boiling Point | 492.14 ºC, 595.7±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 314.0±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H314 Details |
| Precautionary Statements | P264-P270-P271-P280-P304+P340-P305+P351+P338-P310-P330-P331-P363-P403+P233-P501 Details |
| Transport Information | UN 3261 |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,1',1''-(1,3,5-Triazinane-1,3,5-triyl)tris(2-bromoethan-1-one) |