Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | Tetracaine Impurity 12 |
|---|---|
| Synonyms | 4-(Dibutylamino)benzoic acid |
| Molecular Structure |  |
| Protein Sequence | X |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 |
| CAS Registry Number | 92726-05-1 |
| SMILES | CCCCN(CCCC)C1=CC=C(C=C1)C(=O)O |
| Solubility | 1.284 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.543, Calc.* |
| Melting point | 132.53 ºC |
| Boiling Point | 373.04 ºC, 394.0±25.0 ºC (760 mmHg), Calc.* |
| Flash Point | 192.1±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Tetracaine Impurity 12 |