| Dafeng Chemical Com.,Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 16773308882 | |||
![]() |
927608786@qq.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2013 | ||||
| chemBlink standard supplier since 2023 | ||||
| Name | (1R,2S)-3,3-Dimethylcyclopropane-1,2-dicarboxylic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 |
| CAS Registry Number | 936-87-8 |
| EC Number | 882-613-0 |
| SMILES | CC1([C@H]([C@H]1C(=O)O)C(=O)O)C |
| Solubility | 8.732e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.521, Calc.* |
| Melting point | 104.43 ºC |
| Boiling Point | 311.17 ºC, 281.9±23.0 ºC (760 mmHg), Calc.* |
| Flash Point | 138.5±19.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P332+P313-P337+P313-P362-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for (1R,2S)-3,3-Dimethylcyclopropane-1,2-dicarboxylic acid |