| Qingdao Bz Oligo Biotech Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (532) 8192-6227 | |||
![]() |
ann@marine-oligo.com | |||
| Chemical manufacturer since 2010 | ||||
| chemBlink standard supplier since 2016 | ||||
| Name | 2-Acetamido-2-deoxyglucose |
|---|---|
| Synonyms | N-(3,4,5,6-tetrahydroxy-1-oxohexan-2-yl)acetamide;Shrimp shell |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO6 |
| Molecular Weight | 221.21 |
| CAS Registry Number | 98632-70-3 |
| SMILES | CC(=O)NC(C=O)C(C(C(CO)O)O)O |
| Solubility | 1 mg/L (25 ºC water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.542, Calc.* |
| Melting point | 190.96 ºC |
| Boiling Point | 455.41 ºC, 636.4±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 338.7±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Acetamido-2-deoxyglucose |