| NANJING TOMMLAB PHARMATECH Co., LTD | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (025) 8616-1360 | |||
![]() |
tommlab@163.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2020 | ||||
| chemBlink standard supplier since 2020 | ||||
| Name | 3,8-dibromo-6,7-dihydroxy-4-methyl-2H-chromen-2-one |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H6Br2O4 |
| Molecular Weight | 349.96 |
| CAS Registry Number | 98949-03-2 |
| SMILES | CC1=C(C(=O)OC2=C(C(=C(C=C12)O)O)Br)Br |
| Solubility | 217.4 mg/L (25 ºC water) |
|---|---|
| Density | 2.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.725, Calc.* |
| Melting point | 187.25 ºC |
| Boiling Point | 445.74 ºC, 492.8±45.0 ºC (760 mmHg), Calc.* |
| Flash Point | 251.8±28.7 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 3,8-dibromo-6,7-dihydroxy-4-methyl-2H-chromen-2-one |