| Hangzhou Verychem Science And Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (571) 8816-2785 +86 13606544505 | |||
![]() |
lucy@verychem.com | |||
| Chemical manufacturer since 2004 | ||||
| chemBlink massive supplier since 2021 | ||||
| Name | 1,1,1,2,3,3-Hexafluoro-3-(2,2,2-trifluoroethoxy)propane |
|---|---|
| Synonyms | 1,1,2,3,3,3-Hexafluoropropyl 2,2,2-trifluoroethyl ether |
| Molecular Structure | ![]() |
| Molecular Formula | C5H3F9O |
| Molecular Weight | 250.06 |
| CAS Registry Number | 993-95-3 |
| SMILES | C(C(F)(F)F)OC(C(C(F)(F)F)F)(F)F |
| Solubility | 38.57 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.270, Calc.* |
| Melting point | -101.52 ºC |
| Boiling Point | 30.61 ºC, 63.5±40.0 ºC (760 mmHg), Calc.* |
| Flash Point | -2.8±23.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P271-P280 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,2,3,3-Hexafluoro-3-(2,2,2-trifluoroethoxy)propane |