|
CAS: 99593-25-6 Product: Rilmazafone No suppilers available. |
| Name | Rilmazafone |
|---|---|
| Synonyms | 5-[[(2-aminoacetyl)amino]methyl]-1-[4-chloro-2-(2-chlorobenzoyl)phenyl]-N,N-dimethyl-1,2,4-triazole-3-carboxamide |
| Molecular Structure | ![]() |
| Molecular Formula | C21H20Cl2N6O3 |
| Molecular Weight | 475.33 |
| CAS Registry Number | 99593-25-6 |
| SMILES | CN(C)C(=O)C1=NN(C(=N1)CNC(=O)CN)C2=C(C=C(C=C2)Cl)C(=O)C3=CC=CC=C3Cl |
| Solubility | 225.9 mg/L (25 ºC water) |
|---|---|
| Density | 1.5±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.672, Calc.* |
| Melting point | 300.15 ºC |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319 Details |
| Precautionary Statements | P501-P270-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313-P301+P312+P330 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for Rilmazafone |