|
CAS#: 10027-30-2 Product: Copper Phthalate No suppilers available for the product. |
| Name | Copper Phthalate |
|---|---|
| Synonyms | Cupric Phthalate; Ai3-17215 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H4CuO4 |
| Molecular Weight | 227.66 |
| CAS Registry Number | 10027-30-2 |
| EINECS | 233-068-7 |
| SMILES | C1=CC=CC(=C1C([O-])=O)C([O-])=O.[Cu++] |
| InChI | 1S/C8H6O4.Cu/c9-7(10)5-3-1-2-4-6(5)8(11)12;/h1-4H,(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | GSCLWPQCXDSGBU-UHFFFAOYSA-L |
| Boiling point | 378.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 196.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Copper Phthalate |