|
CAS#: 1005-66-9 Product: 2-Bromoethyl-Phenylazanium Bromide No suppilers available for the product. |
| Name | 2-Bromoethyl-Phenylazanium Bromide |
|---|---|
| Synonyms | 2-Bromoethyl-Phenyl-Ammonium Bromide; 2-Bromoethyl-Phenylammonium Bromide; 2-Bromoethyl-Phenyl-Azanium Bromide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11Br2N |
| Molecular Weight | 280.99 |
| CAS Registry Number | 1005-66-9 |
| EINECS | 213-738-5 |
| SMILES | C1=CC=CC=C1[NH2+]CCBr.[Br-] |
| InChI | 1S/C8H10BrN.BrH/c9-6-7-10-8-4-2-1-3-5-8;/h1-5,10H,6-7H2;1H |
| InChIKey | MXNALQRSXHOIEA-UHFFFAOYSA-N |
| Boiling point | 280°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 123.2°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Bromoethyl-Phenylazanium Bromide |