Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | alpha,alpha-Dimethyl-Benzeneethanol Formate |
|---|---|
| Synonyms | (1,1-Dimethyl-2-Phenyl-Ethyl) Formate; Formic Acid (1,1-Dimethyl-2-Phenylethyl) Ester; Formic Acid (1,1-Dimethyl-2-Phenyl-Ethyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 |
| CAS Registry Number | 10058-43-2 |
| FEMA | 2395 |
| SMILES | C1=C(CC(OC=O)(C)C)C=CC=C1 |
| InChI | 1S/C11H14O2/c1-11(2,13-9-12)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | CFSCYYFRHIBXMS-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.202°C at 760 mmHg (Cal.) |
| Flash point | 119.743°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha,alpha-Dimethyl-Benzeneethanol Formate |