|
CAS#: 10075-72-6 Product: 1-Methylsulfanylnaphthalene No suppilers available for the product. |
| Name | 1-Methylsulfanylnaphthalene |
|---|---|
| Synonyms | 1-(Methylthio)Naphthalene; Naphthalene, 1-(Methylthio)-; Naphthalene,1-(Methylthio)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10S |
| Molecular Weight | 174.26 |
| CAS Registry Number | 10075-72-6 |
| SMILES | C1=C2C(=CC=C1)C(=CC=C2)SC |
| InChI | 1S/C11H10S/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3 |
| InChIKey | DKICYCNWKRHPFR-UHFFFAOYSA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 303.729°C at 760 mmHg (Cal.) |
| Flash point | 133.006°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methylsulfanylnaphthalene |