|
CAS#: 10111-02-1 Product: 1-Ethyl-2-Nitro-Benzimidazole No suppilers available for the product. |
| Name | 1-Ethyl-2-Nitro-Benzimidazole |
|---|---|
| Synonyms | 1-Ethyl-2-Nitro-Benzimidazole; Brn 0913554; 5-23-06-00280 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 |
| CAS Registry Number | 10111-02-1 |
| SMILES | C1=CC=CC2=C1[N](C(=N2)[N+]([O-])=O)CC |
| InChI | 1S/C9H9N3O2/c1-2-11-8-6-4-3-5-7(8)10-9(11)12(13)14/h3-6H,2H2,1H3 |
| InChIKey | XMHNVBWYMIMXMY-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.877°C at 760 mmHg (Cal.) |
| Flash point | 184.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-2-Nitro-Benzimidazole |