|
CAS#: 10113-28-7 Product: Phenyl dimethyl phosphate No suppilers available for the product. |
| Name | Phenyl dimethyl phosphate |
|---|---|
| Synonyms | Phosphoric Acid Dimethyl Phenyl Ester; Phenyl Dimethyl Phosphate; Phosphoric Acid, Dimethyl Phenyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H11O4P |
| Molecular Weight | 202.15 |
| CAS Registry Number | 10113-28-7 |
| SMILES | C1=C(C=CC=C1)O[P](=O)(OC)OC |
| InChI | 1S/C8H11O4P/c1-10-13(9,11-2)12-8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | XTBBZRRBOAVBRA-UHFFFAOYSA-N |
| Density | 1.212g/cm3 (Cal.) |
|---|---|
| Boiling point | 226.714°C at 760 mmHg (Cal.) |
| Flash point | 105.079°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl dimethyl phosphate |