|
CAS#: 101706-05-2 Product: Carprofilin No suppilers available for the product. |
| Name | Carprofilin |
|---|---|
| Synonyms | Ethyl 4-(3,7-Dimethyl-2,6-Dioxo-Purin-1-Yl)-3-Oxo-Butanoate; 4-(3,7-Dimethyl-2,6-Dioxo-1-Purinyl)-3-Oxobutanoic Acid Ethyl Ester; 4-(2,6-Diketo-3,7-Dimethyl-Purin-1-Yl)-3-Keto-Butyric Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 |
| CAS Registry Number | 101706-05-2 |
| SMILES | C1=NC2=C([N]1C)C(N(C(N2C)=O)CC(CC(=O)OCC)=O)=O |
| InChI | 1S/C13H16N4O5/c1-4-22-9(19)5-8(18)6-17-12(20)10-11(14-7-15(10)2)16(3)13(17)21/h7H,4-6H2,1-3H3 |
| InChIKey | ODVAGOBDSRFERK-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.648°C at 760 mmHg (Cal.) |
| Flash point | 270.493°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carprofilin |