|
CAS#: 101710-78-5 Product: (1-Cyclohexylpyrrolidin-1-Ium-3-Yl) 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate Chloride No suppilers available for the product. |
| Name | (1-Cyclohexylpyrrolidin-1-Ium-3-Yl) 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate Chloride |
|---|---|
| Synonyms | (1-Cyclohexylpyrrolidin-1-Ium-3-Yl) 2-Cyclopentyl-2-Hydroxy-2-Phenyl-Acetate Chloride; 2-Cyclopentyl-2-Hydroxy-2-Phenylacetic Acid (1-Cyclohexyl-3-Pyrrolidin-1-Iumyl) Ester Chloride; 2-Cyclopentyl-2-Hydroxy-2-Phenyl-Acetic Acid (1-Cyclohexylpyrrolidin-1-Ium-3-Yl) Ester Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C23H34ClNO3 |
| Molecular Weight | 407.98 |
| CAS Registry Number | 101710-78-5 |
| SMILES | C1=CC=CC=C1C(O)(C2CCCC2)C(OC4C[NH+](C3CCCCC3)CC4)=O.[Cl-] |
| InChI | 1S/C23H33NO3.ClH/c25-22(27-21-15-16-24(17-21)20-13-5-2-6-14-20)23(26,19-11-7-8-12-19)18-9-3-1-4-10-18;/h1,3-4,9-10,19-21,26H,2,5-8,11-17H2;1H |
| InChIKey | DGEPCDCYOHENND-UHFFFAOYSA-N |
| Boiling point | 507.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 260.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Cyclohexylpyrrolidin-1-Ium-3-Yl) 2-Cyclopentyl-2-Hydroxy-2-Phenylacetate Chloride |