|
CAS#: 1019-19-8 Product: 1-(2-Dimethylaminoethyl)Cyclohepta[d]Imidazol-2-One No suppilers available for the product. |
| Name | 1-(2-Dimethylaminoethyl)Cyclohepta[d]Imidazol-2-One |
|---|---|
| Synonyms | 1-(2-Dimethylaminoethyl)-2-Cyclohepta[D]Imidazolone; 2(1H)-Cycloheptimidazolone, 1-(2-(Dimethylamino)Ethyl)-; Ametohepazone |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 |
| CAS Registry Number | 1019-19-8 |
| SMILES | C(N(C)C)CN1C(=O)N=C2C=CC=CC=C12 |
| InChI | 1S/C12H15N3O/c1-14(2)8-9-15-11-7-5-3-4-6-10(11)13-12(15)16/h3-7H,8-9H2,1-2H3 |
| InChIKey | QHXNPDVYJSMEJJ-UHFFFAOYSA-N |
| Density | 1.14g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.845°C at 760 mmHg (Cal.) |
| Flash point | 165.381°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Dimethylaminoethyl)Cyclohepta[d]Imidazol-2-One |