|
CAS#: 10207-07-5 Product: N-(4-Phenylbicyclo[2.2.2]Oct-1-Yl)Acetamide No suppilers available for the product. |
| Name | N-(4-Phenylbicyclo[2.2.2]Oct-1-Yl)Acetamide |
|---|---|
| Synonyms | Acetamide, N-(4-phenylbicyclo[2.2.2]oct-1-yl)-; N-(4-Phenylbicyclo[2.2.2]oct-1-yl)acetamide |
| Molecular Structure | ![]() |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.34 |
| CAS Registry Number | 10207-07-5 |
| SMILES | O=C(NC23CCC(c1ccccc1)(CC2)CC3)C |
| InChI | 1S/C16H21NO/c1-13(18)17-16-10-7-15(8-11-16,9-12-16)14-5-3-2-4-6-14/h2-6H,7-12H2,1H3,(H,17,18) |
| InChIKey | VMPACSDMLBCXKA-UHFFFAOYSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 418.758°C at 760 mmHg (Cal.) |
| Flash point | 253.975°C (Cal.) |
| Refractive index | 1.569 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Phenylbicyclo[2.2.2]Oct-1-Yl)Acetamide |