|
CAS#: 10222-95-4 Product: 1,2,4-Trimethyl-5-Propan-2-Ylbenzene No suppilers available for the product. |
| Name | 1,2,4-Trimethyl-5-Propan-2-Ylbenzene |
|---|---|
| Synonyms | 1-Isopropyl-2,4,5-Trimethyl-Benzene; 1-Isopropyl-2,4,5-Trimethylbenzene; 1,2,4-Trimethyl-5-Propan-2-Yl-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.27 |
| CAS Registry Number | 10222-95-4 |
| EINECS | 233-540-2 |
| SMILES | C1=C(C(=CC(=C1C(C)C)C)C)C |
| InChI | 1S/C12H18/c1-8(2)12-7-10(4)9(3)6-11(12)5/h6-8H,1-5H3 |
| InChIKey | POOXAYBPGIHSME-UHFFFAOYSA-N |
| Density | 0.862g/cm3 (Cal.) |
|---|---|
| Boiling point | 218.999°C at 760 mmHg (Cal.) |
| Flash point | 82.438°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4-Trimethyl-5-Propan-2-Ylbenzene |