|
CAS#: 10225-38-4 Product: 2-Allyl-1-Phenyl-1,3-Butanedione No suppilers available for the product. |
| Name | 2-Allyl-1-Phenyl-1,3-Butanedione |
|---|---|
| Synonyms | 2-Allyl-1-phenyl-1,3-butanedione; 2-Allyl-1-phenyl-1,3-butanedione # |
| Molecular Structure | ![]() |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 |
| CAS Registry Number | 10225-38-4 |
| SMILES | O=C(c1ccccc1)C(C(=O)C)C\C=C |
| InChI | 1S/C13H14O2/c1-3-7-12(10(2)14)13(15)11-8-5-4-6-9-11/h3-6,8-9,12H,1,7H2,2H3 |
| InChIKey | QIBVZPSRWCNABO-UHFFFAOYSA-N |
| Density | 1.031g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.983°C at 760 mmHg (Cal.) |
| Flash point | 120.996°C (Cal.) |
| Refractive index | 1.515 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Allyl-1-Phenyl-1,3-Butanedione |