Online Database of Chemicals from Around the World
| Name | 4-(Diethoxyphosphinyl)-2-Butenoic Acid Ethyl Ester |
|---|---|
| Synonyms | Ethyl (E)-4-Diethoxyphosphorylbut-2-Enoate; 4-Diethoxyphosphorylbut-2-Enoic Acid Ethyl Ester; (E)-4-Diethoxyphosphorylbut-2-Enoic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H19O5P |
| Molecular Weight | 250.23 |
| CAS Registry Number | 10236-14-3 |
| SMILES | C(O[P](=O)(OCC)C\C=C\C(=O)OCC)C |
| InChI | 1S/C10H19O5P/c1-4-13-10(11)8-7-9-16(12,14-5-2)15-6-3/h7-8H,4-6,9H2,1-3H3/b8-7+ |
| InChIKey | LXLODBXSCRTXFG-BQYQJAHWSA-N |
| Desity | 1.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.941°C at 760 mmHg (Cal.) |
| Flash point | 167.629°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Diethoxyphosphinyl)-2-Butenoic Acid Ethyl Ester |