|
CAS#: 102386-48-1 Product: Spirasine IV No suppilers available for the product. |
| Name | Spirasine IV |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.42 |
| CAS Registry Number | 102386-48-1 |
| SMILES | [C@]17(CCCC25[C@@H]1[C@@H]6CC34[C@H]2C[C@@H](C(C3)=C)C([C@@H]4C5N6C7)=O)C |
| InChI | 1S/C20H25NO/c1-10-7-19-8-12-16-18(2)4-3-5-20(16)13(19)6-11(10)15(22)14(19)17(20)21(12)9-18/h11-14,16-17H,1,3-9H2,2H3/t11-,12-,13+,14+,16+,17?,18-,19?,20?/m0/s1 |
| InChIKey | AEQMMISNDMJYNF-YVYAJNEFSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.4±40.0°C at 760 mmHg (Cal.) |
| Flash point | 166.1±16.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Spirasine IV |