|
CAS#: 10257-13-3 Product: Desacetyl-1-epiisotenulin No suppilers available for the product. |
| Name | Desacetyl-1-epiisotenulin |
|---|---|
| Synonyms | (1R,3As,5R,5As,8Ar,9R,9As)-9-Hydroxy-1,5,8A-Trimethyl-3A,4,5,5A,9,9A-Hexahydro-1H-Azuleno[7,6-D]Furan-2,8-Quinone; Desacetyl-1-Isotenulin; Azuleno(6,5-B)Furan-2,5-Dione, 3,3A,4,4A,7A,8,9,9A-Octahydro-4-Hydroxy-3,4A,8-Trimethyl-, (3R-(3Alpha,3Aalpha,4Beta,4Abeta,7Abeta,8Alpha,9Abeta))- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 10257-13-3 |
| SMILES | [C@H]12[C@@H](OC(=O)[C@@H]1C)C[C@H]([C@@H]3[C@]([C@@H]2O)(C(=O)C=C3)C)C |
| InChI | 1S/C15H20O4/c1-7-6-10-12(8(2)14(18)19-10)13(17)15(3)9(7)4-5-11(15)16/h4-5,7-10,12-13,17H,6H2,1-3H3/t7-,8-,9-,10+,12-,13-,15+/m1/s1 |
| InChIKey | ICKWITMQEROMDG-QNYKULNCSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.445°C at 760 mmHg (Cal.) |
| Flash point | 169.542°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Desacetyl-1-epiisotenulin |