|
CAS#: 103064-23-9 Product: 5,6,9,10-Tetrahydro-N,N-dimethyl-5,9-methanobenzocycloocten-11-amine No suppilers available for the product. |
| Name | 5,6,9,10-Tetrahydro-N,N-dimethyl-5,9-methanobenzocycloocten-11-amine |
|---|---|
| Synonyms | 5,9-Methanobenzocycloocten-11-Amine, 5,6,9,10-Tetrahydro-N,N-Dimethyl-, (5Alpha,9Alpha,11S*)-(+-)-; Org 6370 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 |
| CAS Registry Number | 103064-23-9 |
| SMILES | C1=CC=CC2=C1C3C(N(C)C)C(C2)C=CC3 |
| InChI | 1S/C15H19N/c1-16(2)15-12-7-5-9-14(15)13-8-4-3-6-11(13)10-12/h3-8,12,14-15H,9-10H2,1-2H3 |
| InChIKey | KUBLWHSLTUANRG-UHFFFAOYSA-N |
| Density | 1.058g/cm3 (Cal.) |
|---|---|
| Boiling point | 296.871°C at 760 mmHg (Cal.) |
| Flash point | 121.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,9,10-Tetrahydro-N,N-dimethyl-5,9-methanobenzocycloocten-11-amine |