|
CAS#: 10311-45-2 Product: 2-[(2,6-Dimethyl-3-Sulfamoylphenyl)Amino]Benzoic Acid No suppilers available for the product. |
| Name | 2-[(2,6-Dimethyl-3-Sulfamoylphenyl)Amino]Benzoic Acid |
|---|---|
| Synonyms | 2-[(2,6-Dimethyl-3-Sulfamoyl-Phenyl)Amino]Benzoic Acid; Anthranilic Acid, N-(3-Sulfamoyl-2,6-Xylyl)-; Brn 2769008 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.36 |
| CAS Registry Number | 10311-45-2 |
| SMILES | C1=CC(=C(C(=C1[S](=O)(=O)N)C)NC2=C(C(=O)O)C=CC=C2)C |
| InChI | 1S/C15H16N2O4S/c1-9-7-8-13(22(16,20)21)10(2)14(9)17-12-6-4-3-5-11(12)15(18)19/h3-8,17H,1-2H3,(H,18,19)(H2,16,20,21) |
| InChIKey | GCYVPIQWKMVIFJ-UHFFFAOYSA-N |
| Density | 1.396g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.97°C at 760 mmHg (Cal.) |
| Flash point | 274.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,6-Dimethyl-3-Sulfamoylphenyl)Amino]Benzoic Acid |