Online Database of Chemicals from Around the World
|
CAS#: 103958-40-3 Product: 2-[(4S)-4-Amino-5,5-Dibutoxypentyl]Guanidine No suppilers available for the product. |
| Name | 2-[(4S)-4-Amino-5,5-Dibutoxypentyl]Guanidine |
|---|---|
| Synonyms | 2-[(4S)-4-Amino-5,5-Dibutoxy-Pentyl]Guanidine; H-Argh(Obu)2; (S)-(4-Amino-5,5-Dibutoxypentyl)Guanidine |
| Molecular Structure | ![CAS#: 103958-40-3, 2-[(4S)-4-Amino-5,5-Dibutoxypentyl]Guanidine](/moreStructures/103958-40-3.gif) |
| Molecular Formula | C14H32N4O2 |
| Molecular Weight | 288.43 |
| CAS Registry Number | 103958-40-3 |
| SMILES | [C@@H](N)(C(OCCCC)OCCCC)CCCN=C(N)N |
| InChI | 1S/C14H32N4O2/c1-3-5-10-19-13(20-11-6-4-2)12(15)8-7-9-18-14(16)17/h12-13H,3-11,15H2,1-2H3,(H4,16,17,18)/t12-/m0/s1 |
| InChIKey | XUIKCSXGRYZONU-LBPRGKRZSA-N |
| Density | 1.091g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.573°C at 760 mmHg (Cal.) |
| Flash point | 218.437°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4S)-4-Amino-5,5-Dibutoxypentyl]Guanidine |