Online Database of Chemicals from Around the World
|
CAS#: 104015-33-0 Product: Cervinomycin A1 Triacetate No suppilers available for the product. |
| Name | Cervinomycin A1 Triacetate |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C35H29NO12 |
| Molecular Weight | 655.61 |
| CAS Registry Number | 104015-33-0 |
| SMILES | C1=C5C(=C(C2=C1CC3(N(C2=O)CCO3)C)OC(=O)C)C4=C(C7=C(C(=C4C=C5)OC(=O)C)OC6=CC(=C(C=C6C7=O)OC)OC)OC(=O)C |
| InChI | 1S/C35H29NO12/c1-15(37)45-30-20-8-7-18-11-19-14-35(4)36(9-10-44-35)34(41)26(19)31(46-16(2)38)25(18)27(20)32(47-17(3)39)28-29(40)21-12-23(42-5)24(43-6)13-22(21)48-33(28)30/h7-8,11-13H,9-10,14H2,1-6H3 |
| InChIKey | DXKVVOOSWPPRHD-UHFFFAOYSA-N |
| Density | 1.519g/cm3 (Cal.) |
|---|---|
| Boiling point | 876.28°C at 760 mmHg (Cal.) |
| Flash point | 483.757°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cervinomycin A1 Triacetate |