|
CAS#: 104575-36-2 Product: 2-(2-Methyl-5-Nitro-1H-Imidazol-1-Yl)Ethyl 3,4,5-Trimethoxybenzoate No suppilers available for the product. |
| Name | 2-(2-Methyl-5-Nitro-1H-Imidazol-1-Yl)Ethyl 3,4,5-Trimethoxybenzoate |
|---|---|
| Synonyms | 2-(2-Methyl-5-Nitro-Imidazol-1-Yl)Ethyl 3,4,5-Trimethoxybenzoate; 3,4,5-Trimethoxybenzoic Acid 2-(2-Methyl-5-Nitro-1-Imidazolyl)Ethyl Ester; 3,4,5-Trimethoxybenzoic Acid 2-(2-Methyl-5-Nitro-Imidazol-1-Yl)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 |
| CAS Registry Number | 104575-36-2 |
| SMILES | C1=C(C=C(OC)C(=C1OC)OC)C(OCC[N]2C(=CN=C2C)[N+]([O-])=O)=O |
| InChI | 1S/C16H19N3O7/c1-10-17-9-14(19(21)22)18(10)5-6-26-16(20)11-7-12(23-2)15(25-4)13(8-11)24-3/h7-9H,5-6H2,1-4H3 |
| InChIKey | SVTLMDWAMSAFIE-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 520.862°C at 760 mmHg (Cal.) |
| Flash point | 268.808°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(2-Methyl-5-Nitro-1H-Imidazol-1-Yl)Ethyl 3,4,5-Trimethoxybenzoate |