|
CAS#: 10468-26-5 Product: N-(1-Cyclohexen-1-Yl)-N-Methylaniline No suppilers available for the product. |
| Name | N-(1-Cyclohexen-1-Yl)-N-Methylaniline |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.28 |
| CAS Registry Number | 10468-26-5 |
| SMILES | c2(N(\C1=C\CCCC1)C)ccccc2 |
| InChI | 1S/C13H17N/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2,4-5,8-10H,3,6-7,11H2,1H3 |
| InChIKey | GNROSMHJEUZVFQ-UHFFFAOYSA-N |
| Density | 1.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.083°C at 760 mmHg (Cal.) |
| Flash point | 114.775°C (Cal.) |
| Refractive index | 1.59 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(1-Cyclohexen-1-Yl)-N-Methylaniline |