|
CAS#: 104753-60-8 Product: 3-Dimethylamino-2,2-Dimethyl-7-Hydroxy-1-Tetralol No suppilers available for the product. |
| Name | 3-Dimethylamino-2,2-Dimethyl-7-Hydroxy-1-Tetralol |
|---|---|
| Synonyms | 3-Dimethylamino-2,2-Dimethyl-Tetralin-1,7-Diol; 3-Dimethylamino-2,2-Dimethyltetralin-1,7-Diol; 1,7-Naphthalenediol, 3-(Dimethylamino)-1,2,3,4-Tetrahydro-2,2-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 |
| CAS Registry Number | 104753-60-8 |
| SMILES | C1=CC(=CC2=C1CC(C(C2O)(C)C)N(C)C)O |
| InChI | 1S/C14H21NO2/c1-14(2)12(15(3)4)7-9-5-6-10(16)8-11(9)13(14)17/h5-6,8,12-13,16-17H,7H2,1-4H3 |
| InChIKey | JLARSPTVJNSNEP-UHFFFAOYSA-N |
| Density | 1.148g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.725°C at 760 mmHg (Cal.) |
| Flash point | 187.459°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Dimethylamino-2,2-Dimethyl-7-Hydroxy-1-Tetralol |