|
CAS#: 104975-31-7 Product: syn-9-Hydroxychrysene-1,2-diol-3,4-epoxide No suppilers available for the product. |
| Name | syn-9-Hydroxychrysene-1,2-diol-3,4-epoxide |
|---|---|
| Synonyms | 1-Alpha,2-Beta,2A-Beta,3A-Beta-Tetrahydrochryseno(3,4-B)Oxirene-1,2,8-Triol; 9-Hydroxy-T-1,T-2-Dihydroxy-T-3,4-Oxy-1,2,3,4-Tetrahydrochrysene; 9-Hydroxychrysene-1,2-Diol-3,4-Oxide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 |
| CAS Registry Number | 104975-31-7 |
| SMILES | [C@@H]15[C@@H]([C@H]([C@@H](C2=CC=C3C(=C12)C=CC4=CC=C(C=C34)O)O)O)O5 |
| InChI | 1S/C18H14O4/c19-9-3-1-8-2-4-11-10(13(8)7-9)5-6-12-14(11)17-18(22-17)16(21)15(12)20/h1-7,15-21H/t15-,16+,17+,18-/m1/s1 |
| InChIKey | PAPRUUIWEKWIAZ-VSZNYVQBSA-N |
| Density | 1.576g/cm3 (Cal.) |
|---|---|
| Boiling point | 632.903°C at 760 mmHg (Cal.) |
| Flash point | 336.568°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for syn-9-Hydroxychrysene-1,2-diol-3,4-epoxide |