|
CAS#: 106033-96-9 Product: Itrocinonide No suppilers available for the product. |
| Name | Itrocinonide |
|---|---|
| Synonyms | Itrocinonide; Itrocinonide [Inn] |
| Molecular Structure | ![]() |
| Molecular Formula | C29H38F2O9 |
| Molecular Weight | 568.61 |
| CAS Registry Number | 106033-96-9 |
| SMILES | [C@]34([C@H]([C@H]2C(F)([C@@]1(C(=CC(=O)C=C1)[C@@H](F)C2)C)[C@@H](O)C3)C[C@H]5O[C@H](O[C@@]45C(O[C@@H](OC(OCC)=O)C)=O)CCC)C |
| InChI | 1S/C29H38F2O9/c1-6-8-23-39-22-13-17-18-12-20(30)19-11-16(32)9-10-26(19,4)28(18,31)21(33)14-27(17,5)29(22,40-23)24(34)37-15(3)38-25(35)36-7-2/h9-11,15,17-18,20-23,33H,6-8,12-14H2,1-5H3/t15-,17-,18-,20-,21-,22+,23+,26-,27-,28?,29-/m0/s1 |
| InChIKey | GCELVROFGZYBHY-ZDJMXOPYSA-N |
| Density | 1.326g/cm3 (Cal.) |
|---|---|
| Boiling point | 625.452°C at 760 mmHg (Cal.) |
| Flash point | 332.062°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Itrocinonide |