|
CAS#: 106871-13-0 Product: [[3-[Bis(2-Chloroethyl)Amino]-4-Methylphenyl]-Hydroxy-Phosphonomethyl]Phosphonic Acid No suppilers available for the product. |
| Name | [[3-[Bis(2-Chloroethyl)Amino]-4-Methylphenyl]-Hydroxy-Phosphonomethyl]Phosphonic Acid |
|---|---|
| Synonyms | [[3-[Bis(2-Chloroethyl)Amino]-4-Methyl-Phenyl]-Hydroxy-Phosphono-Methyl]Phosphonic Acid; Ccris 1232; Phosphonic Acid, ((3-(Bis(2-Chloroethyl)Amino)-4-Methylphenyl)Hydroxymethylene)Bis- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H19Cl2NO7P2 |
| Molecular Weight | 422.14 |
| CAS Registry Number | 106871-13-0 |
| SMILES | C1=C(C(=CC=C1C(O)([P](=O)(O)O)[P](=O)(O)O)C)N(CCCl)CCCl |
| InChI | 1S/C12H19Cl2NO7P2/c1-9-2-3-10(8-11(9)15(6-4-13)7-5-14)12(16,23(17,18)19)24(20,21)22/h2-3,8,16H,4-7H2,1H3,(H2,17,18,19)(H2,20,21,22) |
| InChIKey | SBZOGCANHKAYKV-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 720.257°C at 760 mmHg (Cal.) |
| Flash point | 389.398°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [[3-[Bis(2-Chloroethyl)Amino]-4-Methylphenyl]-Hydroxy-Phosphonomethyl]Phosphonic Acid |