|
CAS#: 107369-98-2 Product: 3,8,9,10,11,12-Hexahydro-2,4-Dimethyl-(1,4)Diazepino(2,3-a)Carbazole No suppilers available for the product. |
| Name | 3,8,9,10,11,12-Hexahydro-2,4-Dimethyl-(1,4)Diazepino(2,3-a)Carbazole |
|---|---|
| Synonyms | 2,4-Dimethyl-3,8,9,10,11,12-Hexahydro-(1,4)Diazepino(2,3-A)Carbazole; 2,4-Dimethyl-8,9,10,11-Tetrahydro-3H-(1,4)Diazepine(2,3-A)Carbazole; Brn 5560546 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 |
| CAS Registry Number | 107369-98-2 |
| SMILES | C2=CC1=C(N=C(CC(=N1)C)C)C3=C2C4=C([NH]3)CCCC4 |
| InChI | 1S/C17H19N3/c1-10-9-11(2)19-17-15(18-10)8-7-13-12-5-3-4-6-14(12)20-16(13)17/h7-8,20H,3-6,9H2,1-2H3 |
| InChIKey | YBCOITSWEXSWIE-UHFFFAOYSA-N |
| Density | 1.297g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.258°C at 760 mmHg (Cal.) |
| Flash point | 232.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,8,9,10,11,12-Hexahydro-2,4-Dimethyl-(1,4)Diazepino(2,3-a)Carbazole |