|
CAS#: 107465-03-2 Product: 1-Chloro-4-[2,2-Dichloro-1-(2-Chlorophenyl)Propyl]Benzene No suppilers available for the product. |
| Name | 1-Chloro-4-[2,2-Dichloro-1-(2-Chlorophenyl)Propyl]Benzene |
|---|---|
| Synonyms | 1-Chloro-2-(2,2-Dichloro-1-(4-Chlorophenyl)Propyl)Benzene; Benzene, 1-Chloro-2-(2,2-Dichloro-1-(4-Chlorophenyl)Propyl)-; Mitometh |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl4 |
| Molecular Weight | 334.07 |
| CAS Registry Number | 107465-03-2 |
| SMILES | C2=C(C(C(Cl)(Cl)C)C1=CC=C(Cl)C=C1)C(=CC=C2)Cl |
| InChI | 1S/C15H12Cl4/c1-15(18,19)14(10-6-8-11(16)9-7-10)12-4-2-3-5-13(12)17/h2-9,14H,1H3 |
| InChIKey | MOTIYCLHZZLHHQ-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.051°C at 760 mmHg (Cal.) |
| Flash point | 195.923°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Chloro-4-[2,2-Dichloro-1-(2-Chlorophenyl)Propyl]Benzene |