|
CAS#: 1076-28-4 Product: 2-Methylquinoline N-oxide No suppilers available for the product. |
| Name | 2-Methylquinoline N-oxide |
|---|---|
| Synonyms | 2-Methyl-1-Oxido-Quinolin-1-Ium; Nsc193529; Nsc 115791 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 |
| CAS Registry Number | 1076-28-4 |
| SMILES | C1=C(C)[N+](=C2C(=C1)C=CC=C2)[O-] |
| InChI | 1S/C10H9NO/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-7H,1H3 |
| InChIKey | FZJUONUBFWNHNU-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.008°C at 760 mmHg (Cal.) |
| Flash point | 144.312°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methylquinoline N-oxide |