Online Database of Chemicals from Around the World
|
CAS#: 107953-78-6 Product: 2-Hydroxy-1,4-Dimethoxyanthracene-9,10-Dione No suppilers available for the product. |
| Name | 2-Hydroxy-1,4-Dimethoxyanthracene-9,10-Dione |
|---|---|
| Synonyms | 2-Hydroxy-1,4-Dimethoxy-Anthracene-9,10-Dione; 2-Hydroxy-1,4-Dimethoxy-9,10-Anthraquinone; 1,4-Dimethoxy-2-Hydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Registry Number | 107953-78-6 |
| SMILES | C1=C(C(=C3C(=C1OC)C(C2=C(C=CC=C2)C3=O)=O)OC)O |
| InChI | 1S/C16H12O5/c1-20-11-7-10(17)16(21-2)13-12(11)14(18)8-5-3-4-6-9(8)15(13)19/h3-7,17H,1-2H3 |
| InChIKey | IVWHLWDPENTYKS-UHFFFAOYSA-N |
| Density | 1.383g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.166°C at 760 mmHg (Cal.) |
| Flash point | 199.747°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxy-1,4-Dimethoxyanthracene-9,10-Dione |