|
CAS#: 108351-35-5 Product: [3-Amino-2-(4-Chlorophenyl)Propyl]Phosphonic Acid No suppilers available for the product. |
| Name | [3-Amino-2-(4-Chlorophenyl)Propyl]Phosphonic Acid |
|---|---|
| Synonyms | Eu-0100967; Ncgc00024483-04; 3-Amino-2-(4-Chlorophenyl)Propanephosphonic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13ClNO3P |
| Molecular Weight | 249.63 |
| CAS Registry Number | 108351-35-5 |
| SMILES | C1=CC(=CC=C1C(C[P](O)(O)=O)CN)Cl |
| InChI | 1S/C9H13ClNO3P/c10-9-3-1-7(2-4-9)8(5-11)6-15(12,13)14/h1-4,8H,5-6,11H2,(H2,12,13,14) |
| InChIKey | VSGNGLJPOGUDON-UHFFFAOYSA-N |
| Density | 1.432g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.145°C at 760 mmHg (Cal.) |
| Flash point | 236.321°C (Cal.) |
| solubility | Soluble to 100 mM in 1eq. NaOH |
| Market Analysis Reports |
| List of Reports Available for [3-Amino-2-(4-Chlorophenyl)Propyl]Phosphonic Acid |