|
CAS#: 108734-89-0 Product: Ethyl 2-[5,6-Bis(4-Methylphenyl)-3-Oxo-1,2,4-Triazin-2-Yl]Propanoate No suppilers available for the product. |
| Name | Ethyl 2-[5,6-Bis(4-Methylphenyl)-3-Oxo-1,2,4-Triazin-2-Yl]Propanoate |
|---|---|
| Synonyms | 2-[5,6-Bis(4-Methylphenyl)-3-Oxo-1,2,4-Triazin-2-Yl]Propanoic Acid Ethyl Ester; 2-[3-Keto-5,6-Bis(4-Methylphenyl)-1,2,4-Triazin-2-Yl]Propionic Acid Ethyl Ester; 1,2,4-Triazine-2(3H)-Acetic Acid, 5,6-Bis(4-Methylphenyl)-Alpha-Methyl-3-Oxo-, Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 |
| CAS Registry Number | 108734-89-0 |
| SMILES | C3=C(C1=NN(C(=O)N=C1C2=CC=C(C=C2)C)C(C(OCC)=O)C)C=CC(=C3)C |
| InChI | 1S/C22H23N3O3/c1-5-28-21(26)16(4)25-22(27)23-19(17-10-6-14(2)7-11-17)20(24-25)18-12-8-15(3)9-13-18/h6-13,16H,5H2,1-4H3 |
| InChIKey | WZDWERCRCNVQJF-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 494.679°C at 760 mmHg (Cal.) |
| Flash point | 252.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 2-[5,6-Bis(4-Methylphenyl)-3-Oxo-1,2,4-Triazin-2-Yl]Propanoate |