| Name | 4-Isopropyl-1,2-Diphenyl-3,5-Pyrazolidinedione |
|---|---|
| Synonyms | 4-Isopropyl-1,2-diphenyl-3,5-pyrazolidinedione #; UQ8520000 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 |
| CAS Registry Number | 1093-68-1 |
| SMILES | O=C2N(c1ccccc1)N(C(=O)C2C(C)C)c3ccccc3 |
| InChI | 1S/C18H18N2O2/c1-13(2)16-17(21)19(14-9-5-3-6-10-14)20(18(16)22)15-11-7-4-8-12-15/h3-13,16H,1-2H3 |
| InChIKey | YCVWEUCCAOLSFZ-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 406.227°C at 760 mmHg (Cal.) |
| Flash point | 167.395°C (Cal.) |
| Refractive index | 1.604 (Cal.) |
| (1) | Selva A, Citterio A, Merlini L. Mass Spectrometry of Heterocyclic compounds. VIII. Electron-impact-induced fragmentation of 1,2-diphenyl-pyrazolidine-3,5-dione and some 4-substituted derivatives, Organic Mass Spectrometry 1975, 10, 606-616 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Isopropyl-1,2-Diphenyl-3,5-Pyrazolidinedione |