|
CAS#: 1102-95-0 Product: 1alpha-Acetylmitomycin C No suppilers available for the product. |
| Name | 1alpha-Acetylmitomycin C |
|---|---|
| Synonyms | Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 1,1A,2,8,8A,8B-Hexahydro-1-Ace; Azirino(2',3':3,4)Pyrrolo(1,2-A)Indole-4,7-Dione, 1,1A,2,8,8A,8B-Hexahydro-1-Acetyl-6-Amino-8-(Hydroxymethyl)-8A-Methoxy-5-Methyl-, Carbamate; Brn 0590954 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 |
| CAS Registry Number | 1102-95-0 |
| SMILES | [C@]13(OC)N(C2=C([C@H]1COC(=O)N)C(=O)C(=C(C2=O)C)N)CC4N(C34)C(=O)C |
| InChI | 1S/C17H20N4O6/c1-6-11(18)14(24)10-8(5-27-16(19)25)17(26-3)15-9(21(15)7(2)22)4-20(17)12(10)13(6)23/h8-9,15H,4-5,18H2,1-3H3,(H2,19,25)/t8-,9?,15?,17-,21?/m1/s1 |
| InChIKey | RLPARBOQTNGFMR-CXJMUXJASA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 654.301°C at 760 mmHg (Cal.) |
| Flash point | 349.509°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1alpha-Acetylmitomycin C |