|
CAS#: 11030-74-3 Product: Nimbic Acid No suppilers available for the product. |
| Name | Nimbic Acid |
|---|---|
| Synonyms | Nimbic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 |
| CAS Registry Number | 11030-74-3 |
| SMILES | [C@@]12([C@@H]([C@@]5(C(C(C1OC3C2=C(C(C3)C4=COC=C4)C)C(=O)O)[C@@](C=CC5=O)(C(=O)O)C)C)CO)C |
| InChI | 1S/C26H30O8/c1-12-14(13-6-8-33-11-13)9-15-19(12)26(4)16(10-27)25(3)17(28)5-7-24(2,23(31)32)20(25)18(22(29)30)21(26)34-15/h5-8,11,14-16,18,20-21,27H,9-10H2,1-4H3,(H,29,30)(H,31,32)/t14?,15?,16-,18?,20?,21?,24-,25+,26-/m1/s1 |
| InChIKey | LACLJUZVQWMXBS-VNQZPSTLSA-N |
| Density | 1.401g/cm3 (Cal.) |
|---|---|
| Boiling point | 648.616°C at 760 mmHg (Cal.) |
| Flash point | 346.07°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nimbic Acid |