|
CAS#: 110452-53-4 Product: (5S)-5-Isopropyl-D-Proline No suppilers available for the product. |
| Name | (5S)-5-Isopropyl-D-Proline |
|---|---|
| Synonyms | (2R,5S)-5-isopropylpyrrolidine-2-carboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 |
| CAS Registry Number | 110452-53-4 |
| SMILES | CC(C)[C@@H]1CC[C@@H](N1)C(=O)O |
| InChI | 1S/C8H15NO2/c1-5(2)6-3-4-7(9-6)8(10)11/h5-7,9H,3-4H2,1-2H3,(H,10,11)/t6-,7+/m0/s1 |
| InChIKey | PIDBLIRWSBCSPG-NKWVEPMBSA-N |
| Density | 1.054g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.83°C at 760 mmHg (Cal.) |
| Flash point | 117.594°C (Cal.) |
| Refractive index | 1.472 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5S)-5-Isopropyl-D-Proline |