|
CAS#: 11051-27-7 Product: Dehydrosqualene No suppilers available for the product. |
| Name | Dehydrosqualene |
|---|---|
| Synonyms | 4,4'-Diapophytoene; C16144; Dehydrosqualene |
| Molecular Structure | ![]() |
| Molecular Formula | C30H48 |
| Molecular Weight | 408.71 |
| CAS Registry Number | 11051-27-7 |
| SMILES | C(C=C(C)C)C\C(=C\CC\C(=C\C=C/C=C(/CC/C=C(/CCC=C(C)C)C)C)C)C |
| InChI | 1S/C30H48/c1-25(2)15-11-19-29(7)23-13-21-27(5)17-9-10-18-28(6)22-14-24-30(8)20-12-16-26(3)4/h9-10,15-18,23-24H,11-14,19-22H2,1-8H3/b10-9-,27-17+,28-18+,29-23+,30-24+ |
| InChIKey | NXJJBCPAGHGVJC-LIKFLUFESA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.7±45.0°C at 760 mmHg (Cal.) |
| Flash point | 258.5±23.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dehydrosqualene |