|
CAS#: 11052-70-3 Product: U-24489 No suppilers available for the product. |
| Name | U-24489 |
|---|---|
| Synonyms | Aids-012145; Aids012145; Methyl 4-(Dimethylamino)-3,5,8,10,11,13-Hexahydroxy-6,13-Dimethyl-9,16-Dioxo-3,4,5,6,9,11,12,13,14,16-Decahydro-2H-2,6-Epoxytetraceno[1,2-B]Oxocine-14-Carboxylate |
| Molecular Structure | ![]() |
| Molecular Formula | C29H31NO12 |
| Molecular Weight | 585.56 |
| CAS Registry Number | 11052-70-3 |
| SMILES | C2=C1C6(OC(OC1=C3C(=C2O)C(=O)C5=C(C3=O)C=C4C(C(O)(CC(O)C4=C5O)C)C(OC)=O)C(O)C(N(C)C)C6O)C |
| InChI | 1S/C29H31NO12/c1-28(39)8-13(32)14-9(18(28)26(38)40-5)6-10-15(21(14)34)22(35)16-12(31)7-11-24(17(16)20(10)33)41-27-23(36)19(30(3)4)25(37)29(11,2)42-27/h6-7,13,18-19,23,25,27,31-32,34,36-37,39H,8H2,1-5H3 |
| InChIKey | UEAXJNKEWITCAW-UHFFFAOYSA-N |
| Density | 1.671g/cm3 (Cal.) |
|---|---|
| Boiling point | 875.819°C at 760 mmHg (Cal.) |
| Flash point | 483.478°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for U-24489 |