|
CAS#: 11055-01-9 Product: Floccosin No suppilers available for the product. |
| Name | Floccosin |
|---|---|
| Synonyms | Floccosin |
| Molecular Structure | ![]() |
| Molecular Formula | C30H26O14 |
| Molecular Weight | 610.53 |
| CAS Registry Number | 11055-01-9 |
| SMILES | C7=C6C(=O)C1(OC1(C24OC2(OC)C(=O)C3=CC5=C(C(=C3C4O)O)C(OC(C5)C)=O)C(O)C6=C(O)C8=C7CC(OC8=O)C)OC |
| InChI | 1S/C30H26O14/c1-9-5-11-7-13-17(19(31)15(11)25(37)41-9)23(35)27(29(39-3,43-27)21(13)33)28-24(36)18-14(22(34)30(28,40-4)44-28)8-12-6-10(2)42-26(38)16(12)20(18)32/h7-10,23-24,31-32,35-36H,5-6H2,1-4H3 |
| InChIKey | UODJUICWDPREDT-UHFFFAOYSA-N |
| Density | 1.783g/cm3 (Cal.) |
|---|---|
| Boiling point | 963.202°C at 760 mmHg (Cal.) |
| Flash point | 320.818°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Floccosin |